Introduction：Basic information about CAS 56355-17-0|Zoliprofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Zoliprofen |
|---|
| CAS Number | 56355-17-0 | Molecular Weight | 249.28600 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 414.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H11NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.4ºC |
|---|
Names
| Name | 2-[4-(1,3-Thiazol-2-yloxy)phenyl]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 414.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H11NO3S |
|---|
| Molecular Weight | 249.28600 |
|---|
| Flash Point | 204.4ºC |
|---|
| Exact Mass | 249.04600 |
|---|
| PSA | 87.66000 |
|---|
| LogP | 3.12350 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | RXZTWBVFHQLTBU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)O)c1ccc(Oc2nccs2)cc1 |
|---|
Synonyms
| Zoliprofeno [INN-Spanish] |
| 2-(4-thiazol-2-yloxy-phenyl)-propionic acid |
| ( inverted exclamation markA)-2-(4-(2-thiazolyloxy)phenyl)propionic acid |
| Zoliprofene [INN-French] |
| Zoliprofenum [INN-Latin] |
| 2-[4-(2-thiazolyloxy)phenyl]propionic acid |
| zoliprofen |
