Introduction：Basic information about CAS 10332-51-1|Potassium saccharate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Potassium saccharate |
|---|
| CAS Number | 10332-51-1 | Molecular Weight | 221.27500 |
|---|
| Density | / | Boiling Point | 438.9ºC at 760mmHg |
|---|
| Molecular Formula | C7H4KNO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.3ºC |
|---|
Names
| Name | potassium,1,1-dioxo-1,2-benzothiazol-2-id-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 438.9ºC at 760mmHg |
|---|
| Molecular Formula | C7H4KNO3S |
|---|
| Molecular Weight | 221.27500 |
|---|
| Flash Point | 219.3ºC |
|---|
| Exact Mass | 220.95500 |
|---|
| PSA | 77.94000 |
|---|
| LogP | 1.08240 |
|---|
| Vapour Pressure | 1.77E-08mmHg at 25°C |
|---|
| InChIKey | HEKURBKACCBNEJ-UHFFFAOYSA-M |
|---|
| SMILES | O=C1[N-]S(=O)(=O)c2ccccc21.[K+] |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| sodium saccharinate |
| potassium saccharinate |
| 1,2-Benzisothiazolin-3-one,1,1-dioxide,potassium salt |
| Potassium saccharin |
| Saccharin,potassium salt |
| UNII-K2BEG3J28N |
| sodium o-sulfobenzimidate |
| Potassium saccharate |
