Introduction：Basic information about CAS 29875-07-8|4-methylbenzylmagnesium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methylbenzylmagnesium chloride |
|---|
| CAS Number | 29875-07-8 | Molecular Weight | 164.91500 |
|---|
| Density | 0.918 g/mL at 25 °C(lit.) | Boiling Point | 65 °C(lit.) |
|---|
| Molecular Formula | C8H9ClMg | Melting Point | / |
|---|
| MSDS | / | Flash Point | 1 °F |
|---|
Names
| Name | magnesium,1-methanidyl-4-methylbenzene,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.918 g/mL at 25 °C(lit.) |
|---|
| Boiling Point | 65 °C(lit.) |
|---|
| Molecular Formula | C8H9ClMg |
|---|
| Molecular Weight | 164.91500 |
|---|
| Flash Point | 1 °F |
|---|
| Exact Mass | 164.02400 |
|---|
| LogP | 3.00020 |
|---|
| Appearance of Characters | Solution | Yellow to green or brown |
|---|
| Vapour Pressure | 7.94mmHg at 25°C |
|---|
| InChIKey | NMQPDYTXGLHYDX-UHFFFAOYSA-M |
|---|
| SMILES | [CH2-]c1ccc(C)cc1.[Cl-].[Mg+2] |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|
| Risk Phrases | R11 |
|---|
| Safety Phrases | 16-26-33-36/37/39-45 |
|---|
| RIDADR | UN 2924 3/PG 2 |
|---|
| WGK Germany | 1 |
|---|
| Hazard Class | 3.0 |
|---|
Synonyms
| 4-methylbenzylmagnesium bromide |
| p-methylbenzylmagnesium chloride |
| p-CH3C6H4CH2MgCl |
| (p-methylphenylmethyl)magnesium chloride |
| MFCD01319893 |
| 4-methylbenzylmagnesiumchloride |
| 4-Methylbenzylmagnesium chloride |
| 4-Methylbenzylmagnesium chloride 0.5 M in Tetrahydrofuran |
| 4-Methylbenzylmagnesium chloride solution |
