Introduction：Basic information about CAS 62123-73-3|ethyl 3-chlorobenzoylformate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 3-chlorobenzoylformate |
|---|
| CAS Number | 62123-73-3 | Molecular Weight | 212.63000 |
|---|
| Density | 1.255g/cm3 | Boiling Point | 88ºC 0,1mm |
|---|
| Molecular Formula | C10H9ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.9ºC |
|---|
Names
| Name | Ethyl 2-(3-chlorophenyl)-2-oxoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.255g/cm3 |
|---|
| Boiling Point | 88ºC 0,1mm |
|---|
| Molecular Formula | C10H9ClO3 |
|---|
| Molecular Weight | 212.63000 |
|---|
| Flash Point | 129.9ºC |
|---|
| Exact Mass | 212.02400 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.08580 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | AORWOAPLLYVOEU-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)c1cccc(Cl)c1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD01319616 |
| ethyl 2-(3-chlorophenyl)-2-oxoacetate |
