Introduction：Basic information about CAS 170702-05-3|5,5'-Dibromo-3,3'-dihexyl-2,2'-bithiophene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,5'-Dibromo-3,3'-dihexyl-2,2'-bithiophene |
|---|
| CAS Number | 170702-05-3 | Molecular Weight | 492.374 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 494.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H28Br2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.6±28.7 °C |
|---|
Names
| Name | 5-bromo-2-(5-bromo-3-hexylthiophen-2-yl)-3-hexylthiophene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 494.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H28Br2S2 |
|---|
| Molecular Weight | 492.374 |
|---|
| Flash Point | 252.6±28.7 °C |
|---|
| Exact Mass | 489.999908 |
|---|
| PSA | 56.48000 |
|---|
| LogP | 11.34 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | MMSTXAGVEKUBED-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCc1cc(Br)sc1-c1sc(Br)cc1CCCCCC |
|---|
Synonyms
| 5-bromo-3-hexyl-2-(5-bromo-3-hexylthiophen-2-yl)thiophene |
| 2,2'-Bithiophene, 5,5'-dibromo-3,3'-dihexyl- |
| 5,5'-Dibromo-3,3'-dihexyl-2,2'-bithiophene |
| 2,2'-Bithiophene,5,5'-dibromo-3,3'-dihexyl |
| D4183 |
