Introduction:Basic information about CAS 17080-02-3|furethrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furethrin |
|---|
| CAS Number | 17080-02-3 | Molecular Weight | 342.42900 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 442.2ºC at 760mmHg |
|---|
| Molecular Formula | C21H26O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.2ºC |
|---|
Names
| Name | furethrin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 442.2ºC at 760mmHg |
|---|
| Molecular Formula | C21H26O4 |
|---|
| Molecular Weight | 342.42900 |
|---|
| Flash Point | 221.2ºC |
|---|
| Exact Mass | 342.18300 |
|---|
| PSA | 56.51000 |
|---|
| LogP | 4.26160 |
|---|
| Vapour Pressure | 5.12E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.542 |
|---|
| InChIKey | BEYOLLQLGMGJDC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)=CC1C(C(=O)OC2CC(=O)C(Cc3ccco3)=C2C)C1(C)C |
|---|
Synonyms
| 3-furfuryl-2-methyl-4-oxocyclopent-2-enyl (±)-cis-trans-chrysanthemate |
| FURETHRIN |
| (RS)-3-furfuryl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS |
| (+-)-Furethionyl (+-)-cis,trans-chrysanthemate |
| (RS)-3-furfuryl-2-methyl-4-oxocyclopent-2-enyl (1RS)-cis-trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |
| 3-(2-furanylmethyl)-2-methyl-4-oxo-2-cyclopenten-1-yl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
| DL-Furfurylrethronyl DL-cis-trans-chrysanthemate |
| [3-(furan-2-ylmethyl)-2-methyl-4-oxocyclopent-2-en-1-yl] 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| (Ξ)-3-(furan-2-ylmethyl)-2-methyl-4-oxocyclopent-2-en-1-yl (1Ξ,3Ξ)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
| Cyclopropanecarboxylic acid,2,2-dimethyl-3-(2-methylpropenyl)-,ester with (+-)-2-furfuryl-4-hydroxy-3-methyl-2-cyclopenten-1-one,(+-)-cis,trans |
| 1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate |