Introduction：Basic information about CAS 17683-99-7|3-FLUORO-6-METHYLANILINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-FLUORO-6-METHYLANILINE |
|---|
| CAS Number | 17683-99-7 | Molecular Weight | 269.25200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-(4-nitrophenyl)-3-phenylprop-2-enoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H11NO4 |
|---|
| Molecular Weight | 269.25200 |
|---|
| Exact Mass | 269.06900 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 3.63430 |
|---|
| InChIKey | LDKNEGCCRUVKMM-GXDHUFHOSA-N |
|---|
| SMILES | O=C(O)C=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
