Introduction：Basic information about CAS 7237-83-4|tris(oxiranylmethyl) benzene-1,2,4-tricarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tris(oxiranylmethyl) benzene-1,2,4-tricarboxylate |
|---|
| CAS Number | 7237-83-4 | Molecular Weight | 378.33000 |
|---|
| Density | 1.432 g/cm3 | Boiling Point | 517.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228.7ºC |
|---|
Names
| Name | tris(oxiran-2-ylmethyl) benzene-1,2,4-tricarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.432 g/cm3 |
|---|
| Boiling Point | 517.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O9 |
|---|
| Molecular Weight | 378.33000 |
|---|
| Flash Point | 228.7ºC |
|---|
| Exact Mass | 378.09500 |
|---|
| PSA | 116.49000 |
|---|
| LogP | 0.35340 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | YNOWBNNLZSSIHM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OCC1CO1)c1ccc(C(=O)OCC2CO2)c(C(=O)OCC2CO2)c1 |
|---|
Synonyms
| Tris(oxiranylmethyl) benzene-1,2,4-tricarboxylate |
| 1,2,4-Benzenetricarboxylicacid,1,2,4-tris(2-oxiranylmethyl) ester |
| EINECS 230-638-7 |
