Introduction：Basic information about CAS 7239-97-6|dimethyl 2,3-diphenoxybutanedioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl 2,3-diphenoxybutanedioate |
|---|
| CAS Number | 7239-97-6 | Molecular Weight | 330.33200 |
|---|
| Density | 1.214g/cm3 | Boiling Point | 456.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.9ºC |
|---|
Names
| Name | dimethyl 2,3-diphenoxybutanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.214g/cm3 |
|---|
| Boiling Point | 456.9ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O6 |
|---|
| Molecular Weight | 330.33200 |
|---|
| Flash Point | 200.9ºC |
|---|
| Exact Mass | 330.11000 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 2.22760 |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | HVPAVISZWQJDNZ-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(Oc1ccccc1)C(Oc1ccccc1)C(=O)OC |
|---|
Synonyms
| Allopseudocodeine,14-hydroxy-,acetate (6CI) |
| 14-Hydroxy-allopseudocodein-8-acetat |
| 14-Hydroxy-8-O-acetyl-allopseudocodein |
| Morphinan-8,14-diol,6,7-didehydro-4,5-epoxy-3-methoxy-17-methyl-,8-acetate,(5a,8a)-(9CI) |
| Tartaric acid,d-O-iphenyl-,dimethyl ester,meso |
| Morphinan-8a,14-diol,6,7-didehydro-4,5a-epoxy-3-methoxy-17-methyl-,8-acetate (8CI) |
| Allopseudocodeine,14-hydroxy-,8-acetate (7CI) |
| 14-Hydroxyallopseudocodeine 8-acetate |
