Introduction:Basic information about CAS 887344-36-7|2-(3',4'-DICHLORO-[1,1'-BIPHENYL]-4-YL)ACETIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3',4'-DICHLORO-[1,1'-BIPHENYL]-4-YL)ACETIC ACID |
|---|
| CAS Number | 887344-36-7 | Molecular Weight | 281.13400 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H10Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-[4-(3,4-dichlorophenyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H10Cl2O2 |
|---|
| Molecular Weight | 281.13400 |
|---|
| Exact Mass | 280.00600 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.28750 |
|---|
| InChIKey | OVVGQMBWSLQKKY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(3',4'-Dichlorobiphenyl-4-yl)acetic acid |
| 2-(3',4'-Dichloro-[1,1'-biphenyl]-4-yl)acetic acid |
| 4BMD-Q04-0 |
| 4-(3,4-Dichlorophenyl)phenylacetic acid |