Introduction：Basic information about CAS 320420-75-5|[[5-chloro-1-[(3,4-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-chlor, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [[5-chloro-1-[(3,4-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-chloropropanoate |
|---|
| CAS Number | 320420-75-5 | Molecular Weight | 446.11100 |
|---|
| Density | 1.53g/cm3 | Boiling Point | 578.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H12Cl4N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 303.4ºC |
|---|
Names
| Name | [[5-chloro-1-[(3,4-dichlorophenyl)methyl]-2-oxoindol-3-ylidene]amino] 3-chloropropanoate |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Boiling Point | 578.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H12Cl4N2O3 |
|---|
| Molecular Weight | 446.11100 |
|---|
| Flash Point | 303.4ºC |
|---|
| Exact Mass | 443.96000 |
|---|
| PSA | 58.97000 |
|---|
| LogP | 5.13480 |
|---|
| Index of Refraction | 1.653 |
|---|
| InChIKey | URHIXYZCUFKWPM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CCCl)ON=C1C(=O)N(Cc2ccc(Cl)c(Cl)c2)c2ccc(Cl)cc21 |
|---|
