Introduction：Basic information about CAS 3792-59-4|(2,4-dichlorophenoxy)-ethoxy-phenyl-sulfanylidene-λ5-phosphane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,4-dichlorophenoxy)-ethoxy-phenyl-sulfanylidene-λ5-phosphane |
|---|
| CAS Number | 3792-59-4 | Molecular Weight | 347.19700 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 415.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H13Cl2O2PS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.2ºC |
|---|
Names
| Name | (2,4-dichlorophenoxy)-ethoxy-phenyl-sulfanylidene-λ5-phosphane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 415.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H13Cl2O2PS |
|---|
| Molecular Weight | 347.19700 |
|---|
| Flash Point | 205.2ºC |
|---|
| Exact Mass | 345.97500 |
|---|
| PSA | 60.36000 |
|---|
| LogP | 5.69430 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | PNAAEIYEUKNTMO-UHFFFAOYSA-N |
|---|
| SMILES | CCOP(=S)(Oc1ccc(Cl)cc1Cl)c1ccccc1 |
|---|
Safety Information
| RIDADR | UN 3018 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| o-(2,4-dichlorphenyl)-o-ethyl-phenylphosphonothioat |
| Phenyl-monothiophosphonsaeure-O-aethyl-O-(2,4-dichlor-phenyl)-ester |
| Phosphonothioic acid,phenyl-,O-(2,4-dichlorophenyl) O-ethyl ester |
| O-2,4-Dichlorfenyl-O-ethylester kyseliny fenylthiofosfonove [Czech] |
| S-7 |
| O-Ethyl O-2,4-dichlorophenyl thionobenzenephosphonate |
| S-Seven |
| EPBP |
| O-2,4-dichlorophenyl O-ethyl phenylphosphonothioate |
| O-Ethyl-O-(2,4-dichlorophenyl)-phosphonothionate |
| O-Aethyl-O-(2,4-dichlor-phenyl)-phenyl-thiophosphonsaeure |
| O-2,4-dichlorophenyl 0-ethyl phenylphosphonothioate |
