Introduction:Basic information about CAS 155601-30-2|4,5-Diamino-1-(2-hydroxyethyl)pyrazole sulfate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-Diamino-1-(2-hydroxyethyl)pyrazole sulfate |
|---|
| CAS Number | 155601-30-2 | Molecular Weight | 240.238 |
|---|
| Density | / | Boiling Point | 407.4ºC at 760mmHg |
|---|
| Molecular Formula | C5H12N4O5S | Melting Point | >183ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 200.2ºC |
|---|
Names
| Name | 4,5-Diamino-1-(2-Hydroxy)Ethyl Pyrazole Sulfate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 407.4ºC at 760mmHg |
|---|
| Melting Point | >183ºC |
|---|
| Molecular Formula | C5H12N4O5S |
|---|
| Molecular Weight | 240.238 |
|---|
| Flash Point | 200.2ºC |
|---|
| Exact Mass | 240.052841 |
|---|
| PSA | 173.07000 |
|---|
| LogP | 0.63020 |
|---|
| Vapour Pressure | 2.29E-07mmHg at 25°C |
|---|
| InChIKey | IBCDZZHMNXXYAP-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cnn(CCO)c1N.O=S(=O)(O)O |
|---|
Safety Information
| Hazard Codes | Xi,N |
|---|
| Risk Phrases | 41-43-51/53 |
|---|
| Safety Phrases | 24-26-37/39-61 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4,5-Diamino-1-(2-hydroxy)ethyl pyrazole sulfate |
| MFCD07368638 |
| 4,5-Diamino-1-(2-hydroxyethyl)pyrazole sulfate |
| 2-(4,5-Diamino-1H-pyrazol-1-yl)ethanol sulfate (salt) |
| 2-(4,5-Diamino-1H-pyrazol-1-yl)ethanol sulfate (1:1) |
| T5NNJ A2Q DZ EZ &&H2SO4 |
| 4,5-Diamino-1-(2-Hydroxyethyl) pyrazole sulfate |
| 2-(4,5-diaminopyrazol-1-yl)ethanol,sulfuric acid |
| EINECS 429-300-3 |
| 1H-Pyrazole-1-ethanol, 4,5-diamino-, sulfate (1:1) (salt) |