Introduction:Basic information about CAS 24245-27-0|[amino(anilino)methylidene]-phenylazanium,chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [amino(anilino)methylidene]-phenylazanium,chloride |
|---|
| CAS Number | 24245-27-0 | Molecular Weight | 247.72300 |
|---|
| Density | / | Boiling Point | 364.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14ClN3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 174.1ºC |
|---|
Names
| Name | [amino(anilino)methylidene]-phenylazanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 364.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14ClN3 |
|---|
| Molecular Weight | 247.72300 |
|---|
| Flash Point | 174.1ºC |
|---|
| Exact Mass | 247.08800 |
|---|
| PSA | 47.91000 |
|---|
| LogP | 4.19310 |
|---|
| Vapour Pressure | 1.7E-05mmHg at 25°C |
|---|
| InChIKey | IEDHGYYAGIASNQ-UHFFFAOYSA-N |
|---|
| SMILES | NC(Nc1ccccc1)=[NH+]c1ccccc1.[Cl-] |
|---|
Safety Information
| Risk Phrases | 22-36/37/38-51/53-62 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | MF0875000 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 9 |
|---|
| HS Code | 2925290090 |
|---|
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| GUANIDINE,1,3-DIPHENYL-,MONOHYDROCHLORIDE |
| Diphenylguanidine hydrochloride |
| 1,3-Diphenylguanidinium chloride |
| EINECS 246-107-8 |
| Diphenylguanidinium chloride |
| N,N'-Diphenyl-guanidin,Hydrochlorid |
| N,N'-diphenylguanidine hydrochloride |
| Guanidine,N,N'-diphenyl-,monohydrochloride |
| N,N'-Diphenylguanidine monohydrochloride |