Introduction：Basic information about CAS 3755-83-7|2-Methyl-4,5-diphenylthiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4,5-diphenylthiazole |
|---|
| CAS Number | 3755-83-7 | Molecular Weight | 251.34600 |
|---|
| Density | 1.147 g/cm3 | Boiling Point | 370.2ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13NS | Melting Point | 44-50 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 174.4ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4,5-diphenyl-2-methylthiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.147 g/cm3 |
|---|
| Boiling Point | 370.2ºC at 760 mmHg |
|---|
| Melting Point | 44-50 °C(lit.) |
|---|
| Molecular Formula | C16H13NS |
|---|
| Molecular Weight | 251.34600 |
|---|
| Flash Point | 174.4ºC |
|---|
| Exact Mass | 251.07700 |
|---|
| PSA | 41.13000 |
|---|
| LogP | 4.78550 |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | ZFYWCVZNRMSXBT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 3335 9 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2-METHYL-4,5-DIPHENYL-THIAZOLE |
| EINECS 223-161-0 |
| MFCD00186396 |
| 2-Methyl-4,5-diphenylthiazole |
| 2-methyl-4,5-diphenyl-1,3-thiazole |
