Introduction：Basic information about CAS 321-69-7|5-Fluoroisatonic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Fluoroisatonic anhydride |
|---|
| CAS Number | 321-69-7 | Molecular Weight | 181.121 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H4FNO3 | Melting Point | 259-262ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-Fluoroisatoic Anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 259-262ºC |
|---|
| Molecular Formula | C8H4FNO3 |
|---|
| Molecular Weight | 181.121 |
|---|
| Exact Mass | 181.017517 |
|---|
| PSA | 63.07000 |
|---|
| LogP | 0.96 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | UBKGOWGNYKVYEF-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2ccc(F)cc2c(=O)o1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-Fluoroisatonic anhydride |
| 6FLUOROISATINANHYDRIDE |
| 6-Fluoro-2H-3,1-benzoxazine-2,4(1H)-dione |
| 6-fluoro-1H-3,1-benzoxazine-2,4-dione |
| 6Fluoroisatinicanhydride |
| 6-Fluoroisatoic anhydride |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-fluoro- |
| 6-fluoranyl-1,3-benzoxazine-2,4-dione |
| MFCD03300719 |
