Introduction:Basic information about CAS 56375-83-8|3,4-Dimethylaniline-6-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4-Dimethylaniline-6-sulfonic acid |
|---|
| CAS Number | 56375-83-8 | Molecular Weight | 201.24300 |
|---|
| Density | 1.368 g/cm3 | Boiling Point | 262-264 °C(lit.) |
|---|
| Molecular Formula | C8H11NO3S | Melting Point | 80-82 °C(lit.) |
|---|
| MSDS | / | Flash Point | 262-264°C |
|---|
Names
| Name | 2-amino-4,5-dimethylbenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.368 g/cm3 |
|---|
| Boiling Point | 262-264 °C(lit.) |
|---|
| Melting Point | 80-82 °C(lit.) |
|---|
| Molecular Formula | C8H11NO3S |
|---|
| Molecular Weight | 201.24300 |
|---|
| Flash Point | 262-264°C |
|---|
| Exact Mass | 201.04600 |
|---|
| PSA | 88.77000 |
|---|
| LogP | 2.79430 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | XROQUIUUGKYCQN-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N)c(S(=O)(=O)O)cc1C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 2811 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| MFCD00036093 |
| 3,4-DIMETHYLANILINE-6-SULFONIC ACID |
| EINECS 260-136-3 |
| 5-Amino-o-xylol-sulfonsaeure-(4) |
| AC-362 |
| 5-Amino-o-xylene-4-sulphonic acid |
| 2-Amino-4,5-dimethylbenzolsulfonsaeure |
| 2-amino-4,5-dimethylbenzene sulfonic acid |