Introduction:Basic information about CAS 142-22-3|Diallyl oxydi-2,1-ethanediyl biscarbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diallyl oxydi-2,1-ethanediyl biscarbonate |
|---|
| CAS Number | 142-22-3 | Molecular Weight | 274.267 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 337.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H18O7 | Melting Point | −4 °C(lit.) |
|---|
| MSDS | / | Flash Point | 145.3±26.5 °C |
|---|
Names
| Name | Diallyl 2,2'-oxydiethyl dicarbonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 337.4±37.0 °C at 760 mmHg |
|---|
| Melting Point | −4 °C(lit.) |
|---|
| Molecular Formula | C12H18O7 |
|---|
| Molecular Weight | 274.267 |
|---|
| Flash Point | 145.3±26.5 °C |
|---|
| Exact Mass | 274.105255 |
|---|
| PSA | 80.29000 |
|---|
| LogP | 2.05 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.455 |
|---|
| InChIKey | JHQVCQDWGSXTFE-UHFFFAOYSA-N |
|---|
| SMILES | C=CCOC(=O)OCCOCCOC(=O)OCC=C |
|---|
| Stability | Stability Combustible. Incompatible with strong oxidizing agents. |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | UN 3237 4.1 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | FG2080000 |
|---|
| HS Code | 2920909090 |
|---|
Customs
| HS Code | 2920909090 |
|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Diallyl oxydiethane-2,1-diyl biscarbonate |
| rav7 |
| Carbonic acid, oxydi-2,1-ethanediyl di-2-propen-1-yl ester |
| 01m |
| O,O'-Bis-allyloxycarbonyl-diaethylenglylkol |
| MFCD00080476 |
| Diaethylenglykol-bis-allylcarbonat |
| 2,5,8-Trioxa-nonandisaeure-diallylester |
| Tastrak |
| transallylcr39 |
| ts16 |
| oxydiethane-2,1-diyl diprop-2-en-1-yl biscarbonate |
| nouryset200 |
| dagc |
| Bis-(2-allyloxycarbonyloxy-aethyl)-aether |
| CR-39(R) |
| cr39 |
| Baryotrak |
| Diallyl oxydi-2,1-ethanediyl biscarbonate |
| 2,5,8-trioxa-nonanedioic acid diallyl ester |
| 2,5,8-Trioxanonanedioic acid di-2-propenyl ester |
| EINECS 205-528-7 |