Introduction：Basic information about CAS 4694-91-1|6-Nitro-3H-benzooxazol-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Nitro-3H-benzooxazol-2-one |
|---|
| CAS Number | 4694-91-1 | Molecular Weight | 180.118 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H4N2O4 | Melting Point | 248-252 °C(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-nitro benzoxazolinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Melting Point | 248-252 °C(lit.) |
|---|
| Molecular Formula | C7H4N2O4 |
|---|
| Molecular Weight | 180.118 |
|---|
| Exact Mass | 180.017105 |
|---|
| PSA | 92.08000 |
|---|
| LogP | 1.30 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | JGYJZHYTADCWIK-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2ccc([N+](=O)[O-])cc2o1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Nitro-3H-benzooxazol-2-one |
| 6-Nitro-2(3H)-benzoxazolone |
| 6-Nitro-1,3-benzoxazol-2(3H)-one |
| 6-Nitrobenzo[d]oxazol-2(3H)-one |
| MFCD00092622 |
| 6-nitro-3H-1,3-benzoxazol-2-one |
| 2(3H)-Benzoxazolone, 6-nitro- |
| 6-Nitrobenzoxazole-2(3H)-one |
| EINECS 225-157-4 |
