Introduction：Basic information about CAS 6265-07-2|2-Amino-6-nitro-p-cresol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-6-nitro-p-cresol |
|---|
| CAS Number | 6265-07-2 | Molecular Weight | 168.15000 |
|---|
| Density | 1.421 g/cm3 | Boiling Point | 299.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 134.7ºC |
|---|
Names
| Name | 2-amino-4-methyl-6-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.421 g/cm3 |
|---|
| Boiling Point | 299.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H8N2O3 |
|---|
| Molecular Weight | 168.15000 |
|---|
| Flash Point | 134.7ºC |
|---|
| Exact Mass | 168.05300 |
|---|
| PSA | 92.07000 |
|---|
| LogP | 2.29540 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | AJWIWEGQLDDWQC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(N)c(O)c([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 5-Nitro-3-amino-4-oxy-1-methyl-benzol |
| 2-Amino-4-methyl-6-nitro-phenol |
| MFCD00035769 |
| 6-Nitro-4-methyl-2-aminophenol |
| 2-nitro-4-methyl-6-amino-phenol |
| 2-amino-6-nitro-4-methylphenol |
| 2-Nitro-3-amino-4-oxy-toluol |
| 2-Amino-6-nitro-p-cresol |
| 2-azanyl-4-methyl-6-nitro-phenol |
| EINECS 228-430-6 |
| 3-amino-4-hydroxy-5-nitrotoluene |
