Introduction：Basic information about CAS 17869-10-2|9,10-Anthracenedione,1-amino-4-hydroxy-2-(2-methoxyethoxy)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-Anthracenedione,1-amino-4-hydroxy-2-(2-methoxyethoxy)- |
|---|
| CAS Number | 17869-10-2 | Molecular Weight | 313.30500 |
|---|
| Density | 1.403g/cm3 | Boiling Point | 581.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H15NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 305.3ºC |
|---|
Names
| Name | 1-amino-4-hydroxy-2-(2-methoxyethoxy)anthracene-9,10-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.403g/cm3 |
|---|
| Boiling Point | 581.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H15NO5 |
|---|
| Molecular Weight | 313.30500 |
|---|
| Flash Point | 305.3ºC |
|---|
| Exact Mass | 313.09500 |
|---|
| PSA | 98.85000 |
|---|
| LogP | 2.35620 |
|---|
| Vapour Pressure | 4.13E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.66 |
|---|
| InChIKey | DVCMHLZPRDGHKK-UHFFFAOYSA-N |
|---|
| SMILES | COCCOc1cc(O)c2c(c1N)C(=O)c1ccccc1C2=O |
|---|
Synonyms
| EINECS 241-820-0 |
| Disperse Red 59 |
| Anthraquinone,1-amino-4-hydroxy-2-(2-methoxyethoxy) |
| C.I. Disperse Red 59 |
| Latyl Cerise B |
| 1-Amino-4-hydroxy-2-(2-methoxyethoxy)anthraquinone |
