Introduction：Basic information about CAS 100833-45-2|4-(4-octoxyphenyl)-4-oxobutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-octoxyphenyl)-4-oxobutanoic acid |
|---|
| CAS Number | 100833-45-2 | Molecular Weight | 306.39700 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 485.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H26O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.5ºC |
|---|
Names
| Name | 4-(4-octoxyphenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 485.3ºC at 760mmHg |
|---|
| Molecular Formula | C18H26O4 |
|---|
| Molecular Weight | 306.39700 |
|---|
| Flash Point | 170.5ºC |
|---|
| Exact Mass | 306.18300 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 4.47340 |
|---|
| Vapour Pressure | 3.13E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.51 |
|---|
| InChIKey | SLXMWMVPAKQKJT-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCOc1ccc(C(=O)CCC(=O)O)cc1 |
|---|
Synonyms
| Benzenebutanoic acid,4-(octyloxy)-g-oxo |
| 4-octyloxxybenzoylpropionic acid |
| 4-[4-(octyloxy)phenyl]-4-oxobutanoic acid |
