Introduction:Basic information about CAS 175135-78-1|2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride |
|---|
| CAS Number | 175135-78-1 | Molecular Weight | 263.74300 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 386.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClNOS | Melting Point | 102ºC |
|---|
| MSDS | / | Flash Point | 187.3ºC |
|---|
Names
| Name | 2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 386.2ºC at 760 mmHg |
|---|
| Melting Point | 102ºC |
|---|
| Molecular Formula | C13H10ClNOS |
|---|
| Molecular Weight | 263.74300 |
|---|
| Flash Point | 187.3ºC |
|---|
| Exact Mass | 263.01700 |
|---|
| PSA | 55.26000 |
|---|
| LogP | 3.92020 |
|---|
| Vapour Pressure | 3.61E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | PSCMJHVAZWDLBP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Sc2ncccc2C(=O)Cl)cc1 |
|---|
Synonyms
| 2-[(4-Methylphenyl)Thio]Pyridine-3-Carbonyl Chloride |