Introduction：Basic information about CAS 6259-08-1|Benzenamine,5-chloro-2-methoxy-4-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenamine,5-chloro-2-methoxy-4-nitro- |
|---|
| CAS Number | 6259-08-1 | Molecular Weight | 202.59500 |
|---|
| Density | 1.452g/cm3 | Boiling Point | 400.1ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7ClN2O3 | Melting Point | 131ºC |
|---|
| MSDS | / | Flash Point | 195.8ºC |
|---|
Names
| Name | 5-chloro-2-methoxy-4-nitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.452g/cm3 |
|---|
| Boiling Point | 400.1ºC at 760 mmHg |
|---|
| Melting Point | 131ºC |
|---|
| Molecular Formula | C7H7ClN2O3 |
|---|
| Molecular Weight | 202.59500 |
|---|
| Flash Point | 195.8ºC |
|---|
| Exact Mass | 202.01500 |
|---|
| PSA | 81.07000 |
|---|
| LogP | 2.94340 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | POKAEVPBUOLQIY-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])c(Cl)cc1N |
|---|
Synonyms
| 5-Chlor-2-methoxy-4-nitro-anilin |
| 2-methoxy-5-chloro-4-nitroaniline |
| 5-Chloro-4-nitro-o-anisidine |
| o-Anisidine,5-chloro-4-nitro |
| 5-chloro-4-nitro-2-anisidine |
| 5-chloro-2-methoxy-4-nitro-aniline |
| 2-amino-4-chloro-5-nitroanisole |
| 5-Chlor-4-nitro-o-anisidin |
