Introduction：Basic information about CAS 215434-39-2|2-[4-[5-chloro-3-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]ethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[4-[5-chloro-3-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]ethanol |
|---|
| CAS Number | 215434-39-2 | Molecular Weight | 309.71500 |
|---|
| Density | 1.367g/cm3 | Boiling Point | 402.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H15ClF3N3O | Melting Point | 58ºC |
|---|
| MSDS | / | Flash Point | 197.2ºC |
|---|
Names
| Name | 2-[4-[5-chloro-3-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl]ethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.367g/cm3 |
|---|
| Boiling Point | 402.4ºC at 760mmHg |
|---|
| Melting Point | 58ºC |
|---|
| Molecular Formula | C12H15ClF3N3O |
|---|
| Molecular Weight | 309.71500 |
|---|
| Flash Point | 197.2ºC |
|---|
| Exact Mass | 309.08600 |
|---|
| PSA | 39.60000 |
|---|
| LogP | 1.87100 |
|---|
| Vapour Pressure | 3.38E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.519 |
|---|
| InChIKey | NYMGNJNWMTZCFC-UHFFFAOYSA-N |
|---|
| SMILES | OCCN1CCN(c2ncc(Cl)cc2C(F)(F)F)CC1 |
|---|
Synonyms
| HMS542A01 |
| 2-{4-[5-chloro-3-(trifluoromethyl)pyridin-2-yl]piperazin-1-yl}ethanol |
| 2-{4-[5-chloro-3-(trifluoromethyl)-2-pyridyl]piperazino}ethan-1-ol |
