Introduction:Basic information about CAS 64779-10-8|4-(4-octylphenyl)-4-oxobutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-octylphenyl)-4-oxobutanoic acid |
|---|
| CAS Number | 64779-10-8 | Molecular Weight | 290.39700 |
|---|
| Density | 1.035g/cm3 | Boiling Point | 463.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H26O3 | Melting Point | 91ºC |
|---|
| MSDS | / | Flash Point | 248.2ºC |
|---|
Names
| Name | 4-(4-octylphenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.035g/cm3 |
|---|
| Boiling Point | 463.4ºC at 760 mmHg |
|---|
| Melting Point | 91ºC |
|---|
| Molecular Formula | C18H26O3 |
|---|
| Molecular Weight | 290.39700 |
|---|
| Flash Point | 248.2ºC |
|---|
| Exact Mass | 290.18800 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 4.63710 |
|---|
| Index of Refraction | 1.514 |
|---|
| InChIKey | OHBXTBNWHICXSV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCc1ccc(C(=O)CCC(=O)O)cc1 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
Synonyms
| Benzenebutanoic acid,4-octyl-g-oxo |
| 4-(4-Octyl-phenyl)-4-oxo-buttersaeure |
| 4-(4-octyl-phenyl)-4-oxo-butyric acid |
| HMS547O21 |