Introduction:Basic information about CAS 5197-95-5|Benzyltriethylammonium Bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyltriethylammonium Bromide |
|---|
| CAS Number | 5197-95-5 | Molecular Weight | 272.224 |
|---|
| Density | 1.2838 | Boiling Point | / |
|---|
| Molecular Formula | C13H22NBr | Melting Point | 193-195 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Benzyltriethylammonium Bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2838 |
|---|
| Melting Point | 193-195 °C (dec.)(lit.) |
|---|
| Molecular Formula | C13H22NBr |
|---|
| Molecular Weight | 272.224 |
|---|
| Exact Mass | 271.093567 |
|---|
| LogP | 0.06710 |
|---|
| Index of Refraction | 1.5260 |
|---|
| InChIKey | CHQVQXZFZHACQQ-UHFFFAOYSA-M |
|---|
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.[Br-] |
|---|
| Water Solubility | soluble |
|---|
Safety Information
| Hazard Codes | Xi:Irritant |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S37/39 |
|---|
| RIDADR | UN 2811 |
|---|
| WGK Germany | 3 |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2827590000 |
|---|
Customs
| HS Code | 2923900090 |
|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00011822 |
| Benzyltriethylammonium bromide |
| benzyl(triethyl)azanium,bromide |
| Benzyl triethyl ammonium bromide (TEBA) |
| N-Benzyl-N,N-diethylethanaminium bromide |
| EINECS 225-986-1 |