Introduction:Basic information about CAS 1860-26-0|UNII:OS816H2S39, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | UNII:OS816H2S39 |
|---|
| CAS Number | 1860-26-0 | Molecular Weight | 353.668 |
|---|
| Density | 0.8±0.1 g/cm3 | Boiling Point | 347.1±10.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H51N | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 148.0±9.1 °C |
|---|
Names
| Name | 2-ethyl-N,N-bis(2-ethylhexyl)hexan-1-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.8±0.1 g/cm3 |
|---|
| Boiling Point | 347.1±10.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H51N |
|---|
| Molecular Weight | 353.668 |
|---|
| Flash Point | 148.0±9.1 °C |
|---|
| Exact Mass | 353.402161 |
|---|
| PSA | 3.24000 |
|---|
| LogP | 10.67 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.452 |
|---|
| InChIKey | BZUDVELGTZDOIG-UHFFFAOYSA-N |
|---|
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)CC(CC)CCCC |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S61 |
|---|
| RIDADR | UN 2735 8/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921199090 |
|---|
Customs
| HS Code | 2921199090 |
|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Ethyl-N,N-bis(2-ethylhexyl)-1-hexanamine |
| 2-ethyl-N,N-bis(2-ethylhexyl)hexylamine |
| 2-ethyl-n,n-bis(2-ethylhexyl)hexan-1-amine |
| tri-(2-ethyl-n-hexyl)amine |
| Trioctylamine |
| tri(2-ethylhexyl)amine |
| EINECS 217-461-0 |
| UNII:OS816H2S39 |
| tris-(2-ethylhexyl)amine |
| 1-Hexanamine, 2-ethyl-N,N-bis(2-ethylhexyl)- |
| 1-Hexanamine,2-ethyl-N,N-bis(2-ethylhexyl) |
| MFCD00042903 |
| Tris(2-ethylhexyl)amine |