Introduction：Basic information about CAS 50743-32-3|4-oxo-6-propan-2-ylchromene-3-carbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-oxo-6-propan-2-ylchromene-3-carbonitrile |
|---|
| CAS Number | 50743-32-3 | Molecular Weight | 213.23200 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 320.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO2 | Melting Point | 119 °C |
|---|
| MSDS | / | Flash Point | 139.3ºC |
|---|
Names
| Name | 4-oxo-6-propan-2-ylchromene-3-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 320.4ºC at 760 mmHg |
|---|
| Melting Point | 119 °C |
|---|
| Molecular Formula | C13H11NO2 |
|---|
| Molecular Weight | 213.23200 |
|---|
| Flash Point | 139.3ºC |
|---|
| Exact Mass | 213.07900 |
|---|
| PSA | 54.00000 |
|---|
| LogP | 2.78808 |
|---|
| Index of Refraction | 1.578 |
|---|
| InChIKey | IMVAJLIIWCJMJP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc2occ(C#N)c(=O)c2c1 |
|---|
Safety Information
Synonyms
| 3-cyano-6-isopropylchromone |
| 6-(1-methylethyl)-4-oxo-4H-1-benzopyran-3-carbonitrile |
| 6-Isopropyl-4-oxo-4H-chromene-3-carbonitrile |
| 6-Isopropylchromone-3-carbonitrile |
| 6-isopropyl-4-oxo-4H-1-benzopyran-3-carbonitrile |
| MFCD00191961 |
