Introduction:Basic information about CAS 95977-29-0|haloxyfop-P, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | haloxyfop-P |
|---|
| CAS Number | 95977-29-0 | Molecular Weight | 361.700 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 420.3±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H12ClF3O4 | Melting Point | 70 - 75°C (lit.) |
|---|
| MSDS | USA | Flash Point | 208.0±28.7 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | haloxyfop-P |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 420.3±45.0 °C at 760 mmHg |
|---|
| Melting Point | 70 - 75°C (lit.) |
|---|
| Molecular Formula | C16H12ClF3O4 |
|---|
| Molecular Weight | 361.700 |
|---|
| Flash Point | 208.0±28.7 °C |
|---|
| Exact Mass | 361.032867 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.80 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.536 |
|---|
| InChIKey | GOCUAJYOYBLQRH-MRVPVSSYSA-N |
|---|
| SMILES | CC(Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H412 |
|---|
| Precautionary Statements | P273 |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 22-52/53 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933399025 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Propanoic acid, 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, (2R)- |
| Haloxyfop-p [iso] |
| (2R)-2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| (R)-2-[4-(3-chloro-5-trifluoromethyl-pyridin-2-yl-oxy)-phenoxy ]-propanoic acid |
| Haloxyfop-P (free acid) |
| R-(+)-2-[4-(3-chloro-5-trifluoromethyl-pyridin-2-yloxy)-phenoxy]propionic acid |
| (2R)-2-(4'-(3''-chloro-5''-trifluoromethyl-2''-pyridyloxy)phenoxy)propionic acid |
| (2R)-2-(4-{[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid |
| haloxyfop-P |
| haloxyfop-R |
| T6NJ BOR DOY1&VQ& CG EXFFF &&R-(+)- Form |
| (R)-2-[4-[[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid |
| (2R)-2-(4-{[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoic acid |
| (R)-2-{4-[3-chloro-5-(trifluoromethyl)-2-pyridyloxy]phenoxy}propionic acid |