Introduction:Basic information about CAS 123342-93-8|2-Chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid |
|---|
| CAS Number | 123342-93-8 | Molecular Weight | 326.75500 |
|---|
| Density | 1.51 | Boiling Point | 546.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11ClN2O4S | Melting Point | 148-151ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 284.3ºC |
|---|
| Symbol | GHS09 | Signal Word | Warning |
|---|
Names
| Name | pyrithiobac |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.51 |
|---|
| Boiling Point | 546.4ºC at 760 mmHg |
|---|
| Melting Point | 148-151ºC |
|---|
| Molecular Formula | C13H11ClN2O4S |
|---|
| Molecular Weight | 326.75500 |
|---|
| Flash Point | 284.3ºC |
|---|
| Exact Mass | 326.01300 |
|---|
| PSA | 106.84000 |
|---|
| LogP | 2.99660 |
|---|
| Vapour Pressure | 8.97E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | QEGVVEOAVNHRAA-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(OC)nc(Sc2cccc(Cl)c2C(=O)O)n1 |
|---|
Safety Information
| Symbol | GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H410 |
|---|
| Precautionary Statements | P273-P501 |
|---|
| Hazard Codes | N |
|---|
| Risk Phrases | 50/53 |
|---|
| Safety Phrases | 60-61 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
Synonyms
| 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]benzoic acid |
| Pyrithiobac |
| 2-chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid |
| pyrithyiobac |
| UNII-3327Q8RB9O |
| 2-chloro-6-[(4,6-dimethoxy-2pyrimidinyl)thio]benzoic acid |
| 2-chloro-6-(4,6-dimethoxypyrimidin-2-ylthio)benzoic acid |
| 6-chloro-2-(4,6-dimethoxypyrimidin-2-ylthio)benzoic acid |
| 2-chloro-6-[(4,6-dimethoxypyrimidin-2-yl)thio]benzoic acid |
| 2-chloro-6-(4,6-dimethoxypyrimidin-2-ylthio)benzoate |
| Pyrithiobac [ISO] |
| 2-Chloro-6-[(4,6-dimethoxy-2-pyrimidinyl)thio]benzoic acid |
| 2-chloro-6-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid |