Introduction：Basic information about CAS 3582-71-6|1,5-dichlorohexamethyltrisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,5-dichlorohexamethyltrisiloxane |
|---|
| CAS Number | 3582-71-6 | Molecular Weight | 277.368 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 184.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H18Cl2O2Si3 | Melting Point | -53 °C |
|---|
| MSDS | / | Flash Point | 53.3±10.8 °C |
|---|
Names
| Name | bis[[chloro(dimethyl)silyl]oxy]-dimethylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 184.0±0.0 °C at 760 mmHg |
|---|
| Melting Point | -53 °C |
|---|
| Molecular Formula | C6H18Cl2O2Si3 |
|---|
| Molecular Weight | 277.368 |
|---|
| Flash Point | 53.3±10.8 °C |
|---|
| Exact Mass | 275.999176 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 6.75 |
|---|
| Vapour Pressure | 1.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.426 |
|---|
| InChIKey | GJIYNWRLGOMDEX-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(Cl)O[Si](C)(C)O[Si](C)(C)Cl |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S28-S36/37/39-S45 |
|---|
| RIDADR | UN 2987 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Trisiloxane, 1,5-dichloro-1,1,3,3,5,5-hexamethyl- |
| 1,5-Dichloro-1,1,3,3,5,5-hexamethyl disiloxane |
| Trisiloxane,1,5-dichloro-1,1,3,3,5,5-hexamethyl |
| 1,3-dichloro hexamethyl trisiloxane |
| MFCD00045147 |
| hexamethyl-1,5-dichlorotrisiloxane |
| EINECS 222-707-5 |
| 1,5-Dichloro-1,1,3,3,5,5-hexamethyltrisiloxane |
| 1,5-dichlorohexamethyltrisiloxane |
| 1,1,3,3,5,5-hexamethyldichlorotrisiloxane |
| 1,5-Dichlor-1,1,3,3,5,5-hexamethyltrisiloxan |
