Introduction:Basic information about CAS 3555-47-3|Tetrakis(trimethylsilyl) orthosilicate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetrakis(trimethylsilyl) orthosilicate |
|---|
| CAS Number | 3555-47-3 | Molecular Weight | 384.839 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 284.4±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H36O4Si5 | Melting Point | -60ºC |
|---|
| MSDS | / | Flash Point | 117.4±23.0 °C |
|---|
Names
| Name | tetrakis(trimethylsilyl) silicate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 284.4±23.0 °C at 760 mmHg |
|---|
| Melting Point | -60ºC |
|---|
| Molecular Formula | C12H36O4Si5 |
|---|
| Molecular Weight | 384.839 |
|---|
| Flash Point | 117.4±23.0 °C |
|---|
| Exact Mass | 384.145996 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 8.31 |
|---|
| Appearance of Characters | liquid |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.417 |
|---|
| InChIKey | VNRWTCZXQWOWIG-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
|---|
| Storage condition | 2~8 ℃ |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Trisiloxane, 1,1,1,5,5,5-hexamethyl-3,3-bis(trimethylsiloxy)- |
| 1,1,1,5,5,5-hexamethyl-3,3-bis-trimethylsilanyloxy-trisiloxane |
| 1,1,1,5,5,5-Hexamethyl-3,3-bis-trimethylsilyloxy-trisiloxan |
| Tetrakis(trimethylsilyl) orthosilicate |
| MFCD00051587 |
| 3.3-Bis-trimethylsiloxy-hexamethyltrisiloxan |
| Orthokieselsaeure-tetrakis-trimethylsilylester |
| EINECS 222-613-4 |
| Tetrakis-trimethylsilyloxy-silan |
| Tetrakis-trimethylsiloxy-silan |
| Silicic acid (HSiO), tetrakis(trimethylsilyl) ester |
| Trisiloxane, 1,1,1,5,5,5-hexamethyl-3,3-bis[(trimethylsilyl)oxy]- |
| Tetrakis(trimethylsiloxy)silane |
| Trisiloxane, 1,1,1,5,5,5-hexamethyl-3,3-bis((trimethylsilyl)oxy)- |