Introduction:Basic information about CAS 73101-65-2|1,2-benzoxazol-3-ylmethanesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-benzoxazol-3-ylmethanesulfonyl chloride |
|---|
| CAS Number | 73101-65-2 | Molecular Weight | 231.65600 |
|---|
| Density | 1.562g/cm3 | Boiling Point | 395.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 193.1ºC |
|---|
Names
| Name | 1,2-benzoxazol-3-ylmethanesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.562g/cm3 |
|---|
| Boiling Point | 395.7ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6ClNO3S |
|---|
| Molecular Weight | 231.65600 |
|---|
| Flash Point | 193.1ºC |
|---|
| Exact Mass | 230.97600 |
|---|
| PSA | 68.55000 |
|---|
| LogP | 2.97720 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | ZREYTLWEJMYKRX-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)Cc1noc2ccccc12 |
|---|
Synonyms
| 1,2-benzisoxazole-3-methanesulfonoyl chloride |
| benzisoxazole-methanesulfonylchloride |
| 1,2-benzisoxazole-3-methane-sulfonyl chloride |
| BEN016 |
| benzisoxazole-methanesulfonic acid chloride |