Introduction：Basic information about CAS 41009-71-6|1,3,5-tris(2-bromopropan-2-yl)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-tris(2-bromopropan-2-yl)benzene |
|---|
| CAS Number | 41009-71-6 | Molecular Weight | 441.03900 |
|---|
| Density | 1.586g/cm3 | Boiling Point | 403.917ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21Br3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.911ºC |
|---|
Names
| Name | 1,3,5-tris(2-bromopropan-2-yl)benzene |
|---|
Chemical & Physical Properties
| Density | 1.586g/cm3 |
|---|
| Boiling Point | 403.917ºC at 760 mmHg |
|---|
| Molecular Formula | C15H21Br3 |
|---|
| Molecular Weight | 441.03900 |
|---|
| Flash Point | 191.911ºC |
|---|
| Exact Mass | 437.91900 |
|---|
| LogP | 6.57660 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | OWKKFICOWGHTMS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Br)c1cc(C(C)(C)Br)cc(C(C)(C)Br)c1 |
|---|
