Introduction：Basic information about CAS 173604-33-6|(4R)-4-(Diphenylmethyl)-1,3-oxazolidin-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4R)-4-(Diphenylmethyl)-1,3-oxazolidin-2-one |
|---|
| CAS Number | 173604-33-6 | Molecular Weight | 253.296 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 472.6±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H15NO2 | Melting Point | 145-148ºC(lit.) |
|---|
| MSDS | / | Flash Point | 239.6±20.4 °C |
|---|
Names
| Name | (4R)-4-benzhydryl-1,3-oxazolidin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 472.6±15.0 °C at 760 mmHg |
|---|
| Melting Point | 145-148ºC(lit.) |
|---|
| Molecular Formula | C16H15NO2 |
|---|
| Molecular Weight | 253.296 |
|---|
| Flash Point | 239.6±20.4 °C |
|---|
| Exact Mass | 253.110275 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.39 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.591 |
|---|
| InChIKey | QEOCTJMBYZNEJH-AWEZNQCLSA-N |
|---|
| SMILES | O=C1NC(C(c2ccccc2)c2ccccc2)CO1 |
|---|
Synonyms
| (4R)-4-(Diphenylmethyl)-1,3-oxazolidin-2-one |
| 2-Oxazolidinone, 4-(diphenylmethyl)-, (4R)- |
| 4-Diphenylmethyloxazolidin-2-one |
| (R)-(+)-4-(Diphenylmethyl)-2-oxazolidinone |
| MFCD01863565 |
| 4-diphenylmethyl-2-oxazolidinone |
