Introduction:Basic information about CAS 21679-12-9|Adenosine,2'-deoxy-2-fluoro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Adenosine,2'-deoxy-2-fluoro- |
|---|
| CAS Number | 21679-12-9 | Molecular Weight | 269.23200 |
|---|
| Density | 2.01g/cm3 | Boiling Point | 696.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H12FN5O3 | Melting Point | 218ºC (dec.) |
|---|
| MSDS | / | Flash Point | 375.1ºC |
|---|
Names
| Name | 2'-deoxy-2-fluoroadenosine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.01g/cm3 |
|---|
| Boiling Point | 696.7ºC at 760 mmHg |
|---|
| Melting Point | 218ºC (dec.) |
|---|
| Molecular Formula | C10H12FN5O3 |
|---|
| Molecular Weight | 269.23200 |
|---|
| Flash Point | 375.1ºC |
|---|
| Exact Mass | 269.09200 |
|---|
| PSA | 119.31000 |
|---|
| Vapour Pressure | 2.25E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.834 |
|---|
| InChIKey | ZWPYUXAXLRFWQC-KVQBGUIXSA-N |
|---|
| SMILES | Nc1nc(F)nc2c1ncn2C1CC(O)C(CO)O1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R22 |
|---|
| Safety Phrases | 26 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2'-deoxy2-fluoroadenosine |
| 2-fluoradenine-2'-deoxyriboside |
| 2-fluoro-2-cyclohexenone |
| fluoro-2 cyclohexene-2 one-1 |
| 2-fluoro-2'-deoxyadenosine |
| 2-Fluorocyclohex-2-enon |
| 2-fluorocyclohex-2-enone |
| 2-Cyclohexen-1-one,2-fluoro |