Introduction:Basic information about CAS 17321-80-1|Glycine,N-(3,4-dichlorobenzoyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Glycine,N-(3,4-dichlorobenzoyl)- |
|---|
| CAS Number | 17321-80-1 | Molecular Weight | 248.06300 |
|---|
| Density | 1.505g/cm3 | Boiling Point | 439.7ºC at 760mmHg |
|---|
| Molecular Formula | C9H7Cl2NO3 | Melting Point | 135-139ºC |
|---|
| MSDS | USA | Flash Point | 219.7ºC |
|---|
Names
| Name | 2-[(3,4-dichlorobenzoyl)amino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.505g/cm3 |
|---|
| Boiling Point | 439.7ºC at 760mmHg |
|---|
| Melting Point | 135-139ºC |
|---|
| Molecular Formula | C9H7Cl2NO3 |
|---|
| Molecular Weight | 248.06300 |
|---|
| Flash Point | 219.7ºC |
|---|
| Exact Mass | 246.98000 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.19870 |
|---|
| Vapour Pressure | 1.66E-08mmHg at 25°C |
|---|
| InChIKey | TVWQKCYNJSKYOP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
|---|
Safety Information
| Hazard Codes | C |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(3,4-dichloro-benzoyl)-glycine |
| N-(3,4-Dichlor-benzoyl)-glycin |
| (3,4-dichloro-benzoylamino)-acetic acid |
| 3.4-Dichlor-hippursaeure |
| 2-(3,4-dichlorobenzamido)acetic acid |
| 3.4-Dichlor-benzaminoessigsaeure |