Introduction：Basic information about CAS 1955-04-0|methyl 3-(chlorocarbonyl)-5-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 3-(chlorocarbonyl)-5-nitrobenzoate |
|---|
| CAS Number | 1955-04-0 | Molecular Weight | 243.60100 |
|---|
| Density | 1.471g/cm3 | Boiling Point | 369.8ºC at 760mmHg |
|---|
| Molecular Formula | C9H6ClNO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.5ºC |
|---|
Names
| Name | methyl 3-carbonochloridoyl-5-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.471g/cm3 |
|---|
| Boiling Point | 369.8ºC at 760mmHg |
|---|
| Molecular Formula | C9H6ClNO5 |
|---|
| Molecular Weight | 243.60100 |
|---|
| Flash Point | 177.5ºC |
|---|
| Exact Mass | 242.99300 |
|---|
| PSA | 89.19000 |
|---|
| LogP | 2.28360 |
|---|
| Vapour Pressure | 1.15E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | DQTOZIJNMYYCJE-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(C(=O)Cl)cc([N+](=O)[O-])c1 |
|---|
Synonyms
| methyl 5-nitro-3-chloroformylbenzoate |
| 3-nitro-5-methoxycarbonyl-benzoylchloride |
| methyl 3-(chlorocarbonyl)-5-nitrobenzoate |
| EINECS 217-789-4 |
| 3-carbomethoxy-5-nitrobenzoyl chloride |
| 3-methoxycarbonyl-5-nitro-benzoic acid chloride |
| 3-chlorocarbonyl-5-nitrobenzoic acid methyl ester |
| 3-methoxycarbonyl-5-nitrobenzoyl chloride |
