Introduction：Basic information about CAS 717-75-9|3-acetyl-5-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-acetyl-5-nitrobenzoic acid |
|---|
| CAS Number | 717-75-9 | Molecular Weight | 209.15600 |
|---|
| Density | 1.439 | Boiling Point | 372.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7NO5 | Melting Point | 174-174.5ºC |
|---|
| MSDS | / | Flash Point | 165.2ºC |
|---|
Names
| Name | 3-acetyl-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.439 |
|---|
| Boiling Point | 372.5ºC at 760 mmHg |
|---|
| Melting Point | 174-174.5ºC |
|---|
| Molecular Formula | C9H7NO5 |
|---|
| Molecular Weight | 209.15600 |
|---|
| Flash Point | 165.2ºC |
|---|
| Exact Mass | 209.03200 |
|---|
| PSA | 100.19000 |
|---|
| LogP | 2.01880 |
|---|
| Index of Refraction | 1.6 |
|---|
| InChIKey | HJPFKIQNBJVASL-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
|---|
Synonyms
| 5-nitro-3-acetyl benzoic acid |
| 3-Acetyl-5-nitro-benzoesaeure |
| Benzoic acid,3-acetyl-5-nitro |
| 3-Acetyl-5-nitrobenzoicacid |
| 3-Nitro-5-acetyl-benzoesaeure |
