Introduction：Basic information about CAS 5623-26-7|1-Propanone,2-hydroxy-1,2-diphenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Propanone,2-hydroxy-1,2-diphenyl- |
|---|
| CAS Number | 5623-26-7 | Molecular Weight | 226.27000 |
|---|
| Density | 1.151g/cm3 | Boiling Point | 373.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | 66-67ºC |
|---|
| MSDS | / | Flash Point | 159.3ºC |
|---|
Names
| Name | 2-hydroxy-1,2-diphenylpropan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.151g/cm3 |
|---|
| Boiling Point | 373.1ºC at 760mmHg |
|---|
| Melting Point | 66-67ºC |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Flash Point | 159.3ºC |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.77700 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | DIVXVZXROTWKIH-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)(C(=O)c1ccccc1)c1ccccc1 |
|---|
Safety Information
Synonyms
| 2-hydroxy-1,2-diphenyl-propan-1-one |
| 2-Hydroxy-2-methyl-1,2-diphenylethanone |
| 2-hydroxy-1,2-diphenyl-1-propanone |
| 2-hydroxy-1-oxo-1,2-diphenyl-propane |
| 1,2-diphenyl-2-hydroxypropanone |
