Introduction：Basic information about CAS 376-73-8|Hexafluoroglutaric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hexafluoroglutaric acid |
|---|
| CAS Number | 376-73-8 | Molecular Weight | 240.057 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 289.6±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H2F6O4 | Melting Point | 88-91 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 104.6±25.9 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | hexafluoroglutaric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 289.6±0.0 °C at 760 mmHg |
|---|
| Melting Point | 88-91 °C(lit.) |
|---|
| Molecular Formula | C5H2F6O4 |
|---|
| Molecular Weight | 240.057 |
|---|
| Flash Point | 104.6±25.9 °C |
|---|
| Exact Mass | 239.985733 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 4.32 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.358 |
|---|
| InChIKey | CCUWGJDGLACFQT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C: Corrosive;Xi: Irritant; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Pentanedioic acid, hexafluoro- |
| perfluoroglutaric acid |
| Hexafluoropentanedioic acid |
| Hexafluoroglutaric acid |
| Pentanedioic acid, 2,2,3,3,4,4-hexafluoro- |
| EINECS 206-813-9 |
| Glutaric acid,hexafluoro |
| hexafluoroglutaric |
| Hexafluor-glutarsaeure |
| F-glutaric acid |
| MFCD00004172 |
| Hexafluoroglutaricacid |
| hexafluoro-pentanedioicaci |
| hexafluoro-pentanedioic acid |
