Introduction：Basic information about CAS 85-95-0|Benzestrol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzestrol |
|---|
| CAS Number | 85-95-0 | Molecular Weight | 298.41900 |
|---|
| Density | 1.063g/cm3 | Boiling Point | 431.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H26O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.8ºC |
|---|
Names
| Name | 4-[3-ethyl-4-(4-hydroxyphenyl)hexan-2-yl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.063g/cm3 |
|---|
| Boiling Point | 431.4ºC at 760 mmHg |
|---|
| Molecular Formula | C20H26O2 |
|---|
| Molecular Weight | 298.41900 |
|---|
| Flash Point | 192.8ºC |
|---|
| Exact Mass | 298.19300 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 5.42130 |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | DUTFBSAKKUNBAL-UHFFFAOYSA-N |
|---|
| SMILES | CCC(c1ccc(O)cc1)C(CC)C(C)c1ccc(O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2907299090 |
|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|---|
Synonyms
| 3-Aethyl-2,4-bis-(4-hydroxy-phenyl)-hexan |
| Octoestrol |
| Benzestrolo |
| BENZESTROL |
| Benzoestrol |
| Ocestrol |
| 3-Aethyl-2,4-bis-(4-hydroxy-phenyl)-hexan,Opt.-inakt. Praeparat vom F: 75grad |
| Benzestrolum |
| 3-ethyl-2,4-bis-(4-hydroxy-phenyl)-hexane |
| Benzoestrolum |
| Chemestrogen |
| 4,4'-(1,2-Diethyl-3-methyl-1,3-propanediyl)bisphenol |
