Introduction：Basic information about CAS 54253-49-5|1,6-Dideoxy-1,1-bis(ethylsulfonyl)-L-mannitol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,6-Dideoxy-1,1-bis(ethylsulfonyl)-L-mannitol |
|---|
| CAS Number | 54253-49-5 | Molecular Weight | 348.43300 |
|---|
| Density | 1.469g/cm3 | Boiling Point | 724.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H24O8S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 391.7ºC |
|---|
Names
| Name | L-Rhamnose Bis(ethylsulfone) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.469g/cm3 |
|---|
| Boiling Point | 724.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H24O8S2 |
|---|
| Molecular Weight | 348.43300 |
|---|
| Flash Point | 391.7ºC |
|---|
| Exact Mass | 348.09100 |
|---|
| PSA | 165.96000 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | GAYPCIYXXTVAMZ-RBXMUDONSA-N |
|---|
| SMILES | CCS(=O)(=O)C(C(O)C(O)C(O)C(C)O)S(=O)(=O)CC |
|---|
Safety Information
Customs
| HS Code | 2905590090 |
|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,1-Bis-aethansulfonyl-1,6-didesoxy-L-mannit |
| 1,1-Bis-aethansulfonyl-L-manno-hexan-2,3,4,5-tetraol |
| 1,6-dideoxy-1,1-bis(ethylsulfonyl) |
| 1,6-Dideoxy-1,1-bis(ethylsulfonyl)-L-Mannitol |
| 1,1-Bis-aethansulfonyl-1-desoxy-L-rhamnit |
| 1,1-bis-ethanesulfonyl-1,6-dideoxy-L-mannitol |
| 1,1-diethylsulfonyl-L-rhamnose |
| 1,1-bis-ethanesulfonyl-L-1,6-dideoxy-mannitol |
