Introduction:Basic information about CAS 27069-16-5|5-(4-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid |
|---|
| CAS Number | 27069-16-5 | Molecular Weight | 218.209 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.6±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O3 | Melting Point | 221-225ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 236.6±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-(4-methoxyphenyl)-1h-pyrazole-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 467.6±35.0 °C at 760 mmHg |
|---|
| Melting Point | 221-225ºC(lit.) |
|---|
| Molecular Formula | C11H10N2O3 |
|---|
| Molecular Weight | 218.209 |
|---|
| Flash Point | 236.6±25.9 °C |
|---|
| Exact Mass | 218.069138 |
|---|
| PSA | 75.21000 |
|---|
| LogP | 1.55 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | VHWPBROOEIJLIW-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(C(=O)O)[nH]n2)cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1H-Pyrazole-5-carboxylic acid, 3-(2-methoxyphenyl)- |
| MFCD03030168 |
| 3-(2-Methoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| 1H-Pyrazole-5-carboxylic acid, 3-(4-methoxyphenyl)- |
| 3-(4-Methoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| 5-(2-methoxyphenyl)-1H-pyrazole-3-carboxylic acid |
| 5-(4-Methoxyphenyl)-1H-pyrazole-3-carboxylic acid |
| 5-(4-methoxyphenyl)pyrazole-3-carboxylic acid |
| 5-(4-methoxyphenyl)-1H-pyrazole-3-carboxylic acid(SALTDATA: FREE) |
| 5-(4-methoxy-phenyl)-1(2)H-pyrazole-3-carboxylic acid |
| 1H-pyrazole-3-carboxylic acid, 5-(2-methoxyphenyl)- |