Introduction：Basic information about CAS 170911-92-9|4-(4-Aminophenyl)piperazine-1-carboxylic acid tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-Aminophenyl)piperazine-1-carboxylic acid tert-butyl ester |
|---|
| CAS Number | 170911-92-9 | Molecular Weight | 277.362 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.1±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H23N3O2 | Melting Point | 94 °C |
|---|
| MSDS | / | Flash Point | 220.6±27.3 °C |
|---|
Names
| Name | tert-butyl 4-(4-aminophenyl)piperazine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 441.1±40.0 °C at 760 mmHg |
|---|
| Melting Point | 94 °C |
|---|
| Molecular Formula | C15H23N3O2 |
|---|
| Molecular Weight | 277.362 |
|---|
| Flash Point | 220.6±27.3 °C |
|---|
| Exact Mass | 277.179016 |
|---|
| PSA | 58.80000 |
|---|
| LogP | 0.98 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | RXFHRKPNLPBDGE-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(N)cc2)CC1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| tert-butyl 4-(4-aminophenyl)piperazine-1-carboxylate |
| tert-Butyl-4-(4-aminophenyl)piperazin-1-carboxylat |
| 2-Methyl-2-propanyl 4-(4-aminophenyl)-1-piperazinecarboxylate |
| 4-(4-Boc-piperazin-1-yl)aniline |
| 1-(tert-butoxycarbonyl)-4-(4-aminophenyl)-piperazine |
| 4-(4-amino-phenyl)-1-piperazinecarboxylic acid,1,1-dimethylethyl ester |
| 4-(4-tert-Butyloxycarbonyl-piperazin-1-yl)aniline |
| 4-(4-(1,1-dimethylethoxycarbonyl)piperazin-1-yl)aniline |
| 4-(4-Aminophenyl)piperazine-1-carboxylic acid tert-butyl ester |
| 1-Piperazinecarboxylic acid, 4-(4-aminophenyl)-, 1,1-dimethylethyl ester |
| 1-BOC-4-(4-AMINOPHENYL)PIPERAZINE |
