Introduction：Basic information about CAS 72411-52-0|5-(4-Fluorophenyl)-1H-pyrazol-3-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(4-Fluorophenyl)-1H-pyrazol-3-amine |
|---|
| CAS Number | 72411-52-0 | Molecular Weight | 177.178 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 435.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8FN3 | Melting Point | 119-123ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 217.1±25.9 °C |
|---|
| Symbol |
GHS05, GHS07 | Signal Word | Danger |
|---|
Names
| Name | 5-(4-fluorophenyl)-2h-pyrazol-3-ylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 435.4±35.0 °C at 760 mmHg |
|---|
| Melting Point | 119-123ºC(lit.) |
|---|
| Molecular Formula | C9H8FN3 |
|---|
| Molecular Weight | 177.178 |
|---|
| Flash Point | 217.1±25.9 °C |
|---|
| Exact Mass | 177.070221 |
|---|
| PSA | 54.70000 |
|---|
| LogP | 1.27 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | QYEHDCXFXONDPV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(-c2ccc(F)cc2)[nH]n1 |
|---|
Safety Information
| Symbol |
GHS05, GHS07 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H318-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn,Xi |
|---|
| Risk Phrases | 22-37/38-41 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-(4-FLUOROPHENYL)-1H-PYRAZOL-3-AMINE |
| 3-Amino-5-(4-fluorophenyl)-1H-pyrazole |
| 5-amino-3-(4-fluorophenyl)pyrazole |
| 5-(4-fluorophenyl) 2H-pyrazole-3-yl-amine |
| 5-(4-fluoro-phenyl)-1(2)H-pyrazol-3-ylamine |
| BUTTPARK 347-81 |
| 5-Amino-3-(4-fluorophenyl)-1H-pyrazole |
| MFCD01023677 |
| 3-(4-Fluorophenyl)-1H-pyrazol-5-amine |
| 3-(4-fluorophenyl)-1H-pyrazole-5-amine |
| 1H-Pyrazol-5-amine, 3-(4-fluorophenyl)- |
