Introduction:Basic information about CAS 69829-90-9|1,3,4-Oxadiazole-2(3H)-thione,5-(4-hydroxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,4-Oxadiazole-2(3H)-thione,5-(4-hydroxyphenyl)- |
|---|
| CAS Number | 69829-90-9 | Molecular Weight | 194.21000 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 248.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 104.1ºC |
|---|
Names
| Name | 4-(5-sulfanylidene-1,3,4-oxadiazolidin-2-ylidene)cyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 248.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O2S |
|---|
| Molecular Weight | 194.21000 |
|---|
| Flash Point | 104.1ºC |
|---|
| Exact Mass | 194.01500 |
|---|
| PSA | 94.14000 |
|---|
| LogP | 2.10480 |
|---|
| Index of Refraction | 1.723 |
|---|
| InChIKey | NGBOFOYNPCHKQQ-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(-c2n[nH]c(=S)o2)cc1 |
|---|
Synonyms
| 4-(5-mercapto-1,3,4-oxadiazol-2-yl)phenol |
| 5-[4-hydroxyphenyl]-1,3,4-oxadiazole-2(3H)-thione |
| 4-(5-sulfanyl-1,3,4-oxadiazol-2-yl)phenol |
| 5-(4-Hydroxy-phenyl)-3H-[1,3,4]oxadiazol-2-thion |
| 5-(4-hydroxy-phenyl)-3H-[1,3,4]oxadiazole-2-thione |