Introduction：Basic information about CAS 6972-60-7|9,10-dimethyl-2,6-diazabicyclo[5.4.0]undeca-8,10,12-triene-3,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9,10-dimethyl-2,6-diazabicyclo[5.4.0]undeca-8,10,12-triene-3,5-dione |
|---|
| CAS Number | 6972-60-7 | Molecular Weight | 204.22500 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 456.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.3ºC |
|---|
Names
| Name | 7,8-dimethyl-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 456.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O2 |
|---|
| Molecular Weight | 204.22500 |
|---|
| Flash Point | 204.3ºC |
|---|
| Exact Mass | 204.09000 |
|---|
| PSA | 58.20000 |
|---|
| LogP | 1.86010 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | RUBWPGJFSBXBDJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc2c(cc1C)NC(=O)CC(=O)N2 |
|---|
Synonyms
| Dimethyl-7,8 benzodiazepine-1,5 dione-2,4 |
| 7,8-Dimethyl-1H-1,5-benzodiazepine-2,4(3H,5H)-dione |
