Introduction：Basic information about CAS 4863-70-1|4-(4-chlorophenyl)-3-phenyl-butan-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(4-chlorophenyl)-3-phenyl-butan-2-one |
|---|
| CAS Number | 4863-70-1 | Molecular Weight | 258.74300 |
|---|
| Density | 1.145g/cm3 | Boiling Point | 339.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15ClO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.6ºC |
|---|
Names
| Name | 4-(4-chlorophenyl)-3-phenylbutan-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.145g/cm3 |
|---|
| Boiling Point | 339.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H15ClO |
|---|
| Molecular Weight | 258.74300 |
|---|
| Flash Point | 207.6ºC |
|---|
| Exact Mass | 258.08100 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.25530 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | BRPUMIYBQYEVHM-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(Cc1ccc(Cl)cc1)c1ccccc1 |
|---|
Synonyms
| 4-(4-chlorophenyl)-3-phenyl-2-butanone |
| 3-Phenyl-4-(p-chlorphenyl)-2-butanon |
| 4-(4-chloro-phenyl)-3-phenyl-butan-2-one |
| 2-Phenyl-1-(4-chlor-phenyl)-butanon-(3) |
| 4-(p-chlorophenyl)-3-phenyl-2-butanone |
| 4-(4-Chlor-phenyl)-3-phenyl-butan-2-on |
